C10H16F3NO — CID 162351710
5,5,6,6-tetramethyl-3-(trifluoromethyl)piperidin-2-one (PubChem CID 162351710) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is 5,5,6,6-tetramethyl-3-(trifluoromethyl)piperidin-2-one.
| Compound Name | 5,5,6,6-tetramethyl-3-(trifluoromethyl)piperidin-2-one |
|---|---|
| PubChem CID | 162351710 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 5,5,6,6-tetramethyl-3-(trifluoromethyl)piperidin-2-one |
| SMILES | CC1(C)CC(C(F)(F)F)C(=O)NC1(C)C |
| InChI | InChI=1S/C10H16F3NO/c1-8(2)5-6(10(11,12)13)7(15)14-9(8,3)4/h6H,5H2,1-4H3,(H,14,15) |
| InChIKey | PGAHLYYYIHHMSK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |