C11H14F3NO2 — CID 154171176
6,6-dimethyl-3-(trifluoromethyl)-1,3,3a,5,7,7a-hexahydroindole-2,4-dione (PubChem CID 154171176) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 6,6-dimethyl-3-(trifluoromethyl)-1,3,3a,5,7,7a-hexahydroindole-2,4-dione.
| Compound Name | 6,6-dimethyl-3-(trifluoromethyl)-1,3,3a,5,7,7a-hexahydroindole-2,4-dione |
|---|---|
| PubChem CID | 154171176 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 6,6-dimethyl-3-(trifluoromethyl)-1,3,3a,5,7,7a-hexahydroindole-2,4-dione |
| SMILES | CC1(C)CC(=O)C2C(C1)NC(=O)C2C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO2/c1-10(2)3-5-7(6(16)4-10)8(9(17)15-5)11(12,13)14/h5,7-8H,3-4H2,1-2H3,(H,15,17) |
| InChIKey | XCEYTZPDSNSOFV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |