C19H34N2O — CID 163169850
9-(butylamino)-3,3-dimethyl-2,4,4a,5,6,7,8,8a,9,9a,10,10a-dodecahydroacridin-1-one (PubChem CID 163169850) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is 9-(butylamino)-3,3-dimethyl-2,4,4a,5,6,7,8,8a,9,9a,10,10a-dodecahydroacridin-1-one.
| Compound Name | 9-(butylamino)-3,3-dimethyl-2,4,4a,5,6,7,8,8a,9,9a,10,10a-dodecahydroacridin-1-one |
|---|---|
| PubChem CID | 163169850 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 9-(butylamino)-3,3-dimethyl-2,4,4a,5,6,7,8,8a,9,9a,10,10a-dodecahydroacridin-1-one |
| SMILES | CCCCNC1C2CCCCC2NC2CC(C)(C)CC(=O)C21 |
| InChI | InChI=1S/C19H34N2O/c1-4-5-10-20-18-13-8-6-7-9-14(13)21-15-11-19(2,3)12-16(22)17(15)18/h13-15,17-18,20-21H,4-12H2,1-3H3 |
| InChIKey | AZNIXMODERNUQH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|