C16H16FNO4 — CID 162354068
2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid (PubChem CID 162354068) has the molecular formula C16H16FNO4 and a molecular weight of 305.31 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid.
| Compound Name | 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 162354068 |
| Molecular Formula | C16H16FNO4 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid |
| SMILES | COc1cc(NCc2ccc(F)cc2)c(C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C16H16FNO4/c1-21-12-7-13(15(16(19)20)14(8-12)22-2)18-9-10-3-5-11(17)6-4-10/h3-8,18H,9H2,1-2H3,(H,19,20) |
| InChIKey | OIOSMASJCIZOBR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |