2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid

C16H16FNO4 — CID 162354068

IUPAC2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid
SMILESCOc1cc(NCc2ccc(F)cc2)c(C(=O)O)c(OC)c1
InChIInChI=1S/C16H16FNO4/c1-21-12-7-13(15(16(19)20)14(8-12)22-2)18-9-10-3-5-11(17)6-4-10/h3-8,18H,9H2,1-2H3,(H,19,20)
InChIKeyOIOSMASJCIZOBR-UHFFFAOYSA-N
MW305.31 g/mol
LogP3.15
Rot. Bonds6

About 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid

2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid (PubChem CID 162354068) has the molecular formula C16H16FNO4 and a molecular weight of 305.31 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid.

Molecular Properties

Compound Name2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid
PubChem CID162354068
Molecular FormulaC16H16FNO4
Molecular Weight305.31 g/mol
Exact Mass305.11
IUPAC Name2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid
SMILESCOc1cc(NCc2ccc(F)cc2)c(C(=O)O)c(OC)c1
InChIInChI=1S/C16H16FNO4/c1-21-12-7-13(15(16(19)20)14(8-12)22-2)18-9-10-3-5-11(17)6-4-10/h3-8,18H,9H2,1-2H3,(H,19,20)
InChIKeyOIOSMASJCIZOBR-UHFFFAOYSA-N
XLogP3.15
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.31
LogP ≤ 53.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid?
The IUPAC name of 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid (CID 162354068) is 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid.
What is the SMILES notation for 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid?
The canonical SMILES for 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid is COc1cc(NCc2ccc(F)cc2)c(C(=O)O)c(OC)c1.
What is the InChIKey of 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid?
The InChIKey is OIOSMASJCIZOBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FNO4/c1-21-12-7-13(15(16(19)20)14(8-12)22-2)18-9-10-3-5-11(17)6-4-10/h3-8,18H,9H2,1-2H3,(H,19,20).
What are the key properties of 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid?
2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid has a molecular weight of 305.31 g/mol, XLogP of 3.15, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluorophenyl)methylamino]-4,6-dimethoxybenzoic acid is sourced from PubChem (CID 162354068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).