C19H20N2O2S — CID 162354189
3-cyano-N-(cyclopropylmethyl)-4-(4-ethylphenyl)benzenesulfonamide (PubChem CID 162354189) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 3-cyano-N-(cyclopropylmethyl)-4-(4-ethylphenyl)benzenesulfonamide.
| Compound Name | 3-cyano-N-(cyclopropylmethyl)-4-(4-ethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 162354189 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-cyano-N-(cyclopropylmethyl)-4-(4-ethylphenyl)benzenesulfonamide |
| SMILES | CCc1ccc(-c2ccc(S(=O)(=O)NCC3CC3)cc2C#N)cc1 |
| InChI | InChI=1S/C19H20N2O2S/c1-2-14-5-7-16(8-6-14)19-10-9-18(11-17(19)12-20)24(22,23)21-13-15-3-4-15/h5-11,15,21H,2-4,13H2,1H3 |
| InChIKey | OTUNFVNSSKTAEH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |