C19H24InNO2 — CID 162360753
(R)-[(2R,5S)-5-ethenyl-1-methylindiginan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 162360753) has the molecular formula C19H24InNO2 and a molecular weight of 413.22 g/mol. Its IUPAC name is (R)-[(2R,5S)-5-ethenyl-1-methylindiginan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | (R)-[(2R,5S)-5-ethenyl-1-methylindiginan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 162360753 |
| Molecular Formula | C19H24InNO2 |
| Molecular Weight | 413.22 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | (R)-[(2R,5S)-5-ethenyl-1-methylindiginan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=C[C@@H]1CC[C@H]([C@H](O)c2ccnc3ccc(OC)cc23)[In](C)C1 |
| InChI | InChI=1S/C18H21NO2.CH3.In/c1-4-13(2)6-5-7-18(20)15-10-11-19-17-9-8-14(21-3)12-16(15)17;;/h4,7-13,18,20H,1-2,5-6H2,3H3;1H3;/t13-,18+;;/m1../s1 |
| InChIKey | JWIYORTUPNMRKK-BNTHFPBMSA-N |
| XLogP | 4.37 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.22 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|