C29H35N2O3+ — CID 88900304
[5-ethenyl-1-[(4-methoxyphenyl)methyl]-1-azoniabicyclo[5.2.0]nonan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 88900304) has the molecular formula C29H35N2O3+ and a molecular weight of 459.61 g/mol. Its IUPAC name is [5-ethenyl-1-[(4-methoxyphenyl)methyl]-1-azoniabicyclo[5.2.0]nonan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | [5-ethenyl-1-[(4-methoxyphenyl)methyl]-1-azoniabicyclo[5.2.0]nonan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 88900304 |
| Molecular Formula | C29H35N2O3+ |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | [5-ethenyl-1-[(4-methoxyphenyl)methyl]-1-azoniabicyclo[5.2.0]nonan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=CC1CCC(C(O)c2ccnc3ccc(OC)cc23)[N+]2(Cc3ccc(OC)cc3)CCC2C1 |
| InChI | InChI=1S/C29H35N2O3/c1-4-20-7-12-28(29(32)25-13-15-30-27-11-10-24(34-3)18-26(25)27)31(16-14-22(31)17-20)19-21-5-8-23(33-2)9-6-21/h4-6,8-11,13,15,18,20,22,28-29,32H,1,7,12,14,16-17,19H2,2-3H3/q+1 |
| InChIKey | LGDXMELPBZOGGY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|