C29H31F4N2O2+ — CID 88900332
[5-ethenyl-1-[(2,3,5,6-tetrafluoro-4-methylphenyl)methyl]-1-azoniabicyclo[5.2.0]nonan-2-yl]-(6-methoxyquinolin-4-yl)methanol (PubChem CID 88900332) has the molecular formula C29H31F4N2O2+ and a molecular weight of 515.57 g/mol. Its IUPAC name is [5-ethenyl-1-[(2,3,5,6-tetrafluoro-4-methylphenyl)methyl]-1-azoniabicyclo[5.2.0]nonan-2-yl]-(6-methoxyquinolin-4-yl)methanol.
| Compound Name | [5-ethenyl-1-[(2,3,5,6-tetrafluoro-4-methylphenyl)methyl]-1-azoniabicyclo[5.2.0]nonan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
|---|---|
| PubChem CID | 88900332 |
| Molecular Formula | C29H31F4N2O2+ |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | [5-ethenyl-1-[(2,3,5,6-tetrafluoro-4-methylphenyl)methyl]-1-azoniabicyclo[5.2.0]nonan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| SMILES | C=CC1CCC(C(O)c2ccnc3ccc(OC)cc23)[N+]2(Cc3c(F)c(F)c(C)c(F)c3F)CCC2C1 |
| InChI | InChI=1S/C29H31F4N2O2/c1-4-17-5-8-24(29(36)20-9-11-34-23-7-6-19(37-3)14-21(20)23)35(12-10-18(35)13-17)15-22-27(32)25(30)16(2)26(31)28(22)33/h4,6-7,9,11,14,17-18,24,29,36H,1,5,8,10,12-13,15H2,2-3H3/q+1 |
| InChIKey | CAZKKPOHHZTONQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|