C29H38N6O3 — CID 162360828
(3-methoxyazetidin-1-yl)-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone (PubChem CID 162360828) has the molecular formula C29H38N6O3 and a molecular weight of 518.66 g/mol. Its IUPAC name is (3-methoxyazetidin-1-yl)-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone.
| Compound Name | (3-methoxyazetidin-1-yl)-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone |
|---|---|
| PubChem CID | 162360828 |
| Molecular Formula | C29H38N6O3 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | (3-methoxyazetidin-1-yl)-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone |
| SMILES | COC1CN(C(=O)C2CCC(c3ccc(N4CC[C@@H](Oc5c(C)nc6nc(C)nn6c5C)C4)cc3)CC2)C1 |
| InChI | InChI=1S/C29H38N6O3/c1-18-27(19(2)35-29(30-18)31-20(3)32-35)38-25-13-14-33(15-25)24-11-9-22(10-12-24)21-5-7-23(8-6-21)28(36)34-16-26(17-34)37-4/h9-12,21,23,25-26H,5-8,13-17H2,1-4H3/t21?,23?,25-/m1/s1 |
| InChIKey | ZCLKDEHAASWXRD-LQOCYXTFSA-N |
| XLogP | 3.84 |
| TPSA | 85.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|