C31H42N6O3 — CID 168803185
[(2R,6R)-2,6-dimethylmorpholin-4-yl]-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone (PubChem CID 168803185) has the molecular formula C31H42N6O3 and a molecular weight of 546.72 g/mol. Its IUPAC name is [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone.
| Compound Name | [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone |
|---|---|
| PubChem CID | 168803185 |
| Molecular Formula | C31H42N6O3 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | [(2R,6R)-2,6-dimethylmorpholin-4-yl]-[4-[4-[(3R)-3-[(2,5,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)oxy]pyrrolidin-1-yl]phenyl]cyclohexyl]methanone |
| SMILES | Cc1nc2nc(C)c(O[C@@H]3CCN(c4ccc(C5CCC(C(=O)N6C[C@@H](C)O[C@H](C)C6)CC5)cc4)C3)c(C)n2n1 |
| InChI | InChI=1S/C31H42N6O3/c1-19-16-36(17-20(2)39-19)30(38)26-8-6-24(7-9-26)25-10-12-27(13-11-25)35-15-14-28(18-35)40-29-21(3)32-31-33-23(5)34-37(31)22(29)4/h10-13,19-20,24,26,28H,6-9,14-18H2,1-5H3/t19-,20-,24?,26?,28-/m1/s1 |
| InChIKey | UWLRSFPAWCABFQ-CSQCORFZSA-N |
| XLogP | 4.62 |
| TPSA | 85.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|