C16H24 — CID 162365229
2-(4-methylcyclohex-2-en-1-yl)-5-propan-2-ylcyclohexa-1,3-diene (PubChem CID 162365229) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 2-(4-methylcyclohex-2-en-1-yl)-5-propan-2-ylcyclohexa-1,3-diene.
| Compound Name | 2-(4-methylcyclohex-2-en-1-yl)-5-propan-2-ylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 162365229 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 2-(4-methylcyclohex-2-en-1-yl)-5-propan-2-ylcyclohexa-1,3-diene |
| SMILES | CC1C=CC(C2=CCC(C(C)C)C=C2)CC1 |
| InChI | InChI=1S/C16H24/c1-12(2)14-8-10-16(11-9-14)15-6-4-13(3)5-7-15/h4,6,8,10-15H,5,7,9H2,1-3H3 |
| InChIKey | JFQCPWGYADMPHH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|