C23H20Cl2O4 — CID 162365533
chloromethane;2-[4-[(4-chlorophenyl)methoxy]phenyl]-2,3-dihydro-1,4-benzodioxine-6-carbaldehyde (PubChem CID 162365533) has the molecular formula C23H20Cl2O4 and a molecular weight of 431.32 g/mol. Its IUPAC name is chloromethane;2-[4-[(4-chlorophenyl)methoxy]phenyl]-2,3-dihydro-1,4-benzodioxine-6-carbaldehyde.
| Compound Name | chloromethane;2-[4-[(4-chlorophenyl)methoxy]phenyl]-2,3-dihydro-1,4-benzodioxine-6-carbaldehyde |
|---|---|
| PubChem CID | 162365533 |
| Molecular Formula | C23H20Cl2O4 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | chloromethane;2-[4-[(4-chlorophenyl)methoxy]phenyl]-2,3-dihydro-1,4-benzodioxine-6-carbaldehyde |
| SMILES | CCl.O=Cc1ccc2c(c1)OCC(c1ccc(OCc3ccc(Cl)cc3)cc1)O2 |
| InChI | InChI=1S/C22H17ClO4.CH3Cl/c23-18-6-1-15(2-7-18)13-25-19-8-4-17(5-9-19)22-14-26-21-11-16(12-24)3-10-20(21)27-22;1-2/h1-12,22H,13-14H2;1H3 |
| InChIKey | KLRCPBBGFYQDHF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|