C17H27N5O3S2 — CID 162370822
1-pentyl-3-[[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]carbamothioylamino]thiourea (PubChem CID 162370822) has the molecular formula C17H27N5O3S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 1-pentyl-3-[[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]carbamothioylamino]thiourea.
| Compound Name | 1-pentyl-3-[[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 162370822 |
| Molecular Formula | C17H27N5O3S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1-pentyl-3-[[(E)-(3,4,5-trimethoxyphenyl)methylideneamino]carbamothioylamino]thiourea |
| SMILES | CCCCCNC(=S)NNC(=S)N/N=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C17H27N5O3S2/c1-5-6-7-8-18-16(26)21-22-17(27)20-19-11-12-9-13(23-2)15(25-4)14(10-12)24-3/h9-11H,5-8H2,1-4H3,(H2,18,21,26)(H2,20,22,27)/b19-11+ |
| InChIKey | JHLJLUKHXYVOJG-YBFXNURJSA-N |
| XLogP | 2.08 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|