C17H16FN5O8P- — CID 162370997
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2-fluorobenzoyl) phosphate (PubChem CID 162370997) has the molecular formula C17H16FN5O8P- and a molecular weight of 468.31 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2-fluorobenzoyl) phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2-fluorobenzoyl) phosphate |
|---|---|
| PubChem CID | 162370997 |
| Molecular Formula | C17H16FN5O8P- |
| Molecular Weight | 468.31 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl (2-fluorobenzoyl) phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OC(=O)c2ccccc2F)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H17FN5O8P/c18-9-4-2-1-3-8(9)17(26)31-32(27,28)29-5-10-12(24)13(25)16(30-10)23-7-22-11-14(19)20-6-21-15(11)23/h1-4,6-7,10,12-13,16,24-25H,5H2,(H,27,28)(H2,19,20,21)/p-1/t10-,12-,13-,16-/m1/s1 |
| InChIKey | RVYOOYJAYCGOJN-XNIJJKJLSA-M |
| XLogP | -0.49 |
| TPSA | 194.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.31 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|