C23H40N2O2Sn — CID 162372933
5-butylnonan-5-yl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]tin (PubChem CID 162372933) has the molecular formula C23H40N2O2Sn and a molecular weight of 495.30 g/mol. Its IUPAC name is 5-butylnonan-5-yl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]tin.
| Compound Name | 5-butylnonan-5-yl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]tin |
|---|---|
| PubChem CID | 162372933 |
| Molecular Formula | C23H40N2O2Sn |
| Molecular Weight | 495.30 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 5-butylnonan-5-yl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]tin |
| SMILES | CCCCC(CCCC)(CCCC)[Sn]c1ncccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H27.C10H13N2O2.Sn/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-10(2,3)14-9(13)12-8-5-4-6-11-7-8;/h4-12H2,1-3H3;4-6H,1-3H3,(H,12,13); |
| InChIKey | UMGFEKONBXZGFP-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.30 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |