C40H36O10P2PdS2 — CID 162373258
bis(2-bis(2-methoxyphenyl)phosphanylbenzenesulfonate);palladium(2+) (PubChem CID 162373258) has the molecular formula C40H36O10P2PdS2 and a molecular weight of 909.22 g/mol. Its IUPAC name is bis(2-bis(2-methoxyphenyl)phosphanylbenzenesulfonate);palladium(2+).
| Compound Name | bis(2-bis(2-methoxyphenyl)phosphanylbenzenesulfonate);palladium(2+) |
|---|---|
| PubChem CID | 162373258 |
| Molecular Formula | C40H36O10P2PdS2 |
| Molecular Weight | 909.22 g/mol |
| Exact Mass | 908.03 |
| IUPAC Name | bis(2-bis(2-methoxyphenyl)phosphanylbenzenesulfonate);palladium(2+) |
| SMILES | COc1ccccc1P(c1ccccc1OC)c1ccccc1S(=O)(=O)[O-].COc1ccccc1P(c1ccccc1OC)c1ccccc1S(=O)(=O)[O-].[Pd+2] |
| InChI | InChI=1S/2C20H19O5PS.Pd/c2*1-24-15-9-3-5-11-17(15)26(18-12-6-4-10-16(18)25-2)19-13-7-8-14-20(19)27(21,22)23;/h2*3-14H,1-2H3,(H,21,22,23);/q;;+2/p-2 |
| InChIKey | VWXKASSMUHUHHM-UHFFFAOYSA-L |
| XLogP | 4.73 |
| TPSA | 151.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.22 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|