C17H20N2O7S — CID 162373676
N-[2,2-dimethoxy-1-(3-methoxyphenyl)ethyl]-4-nitrobenzenesulfonamide (PubChem CID 162373676) has the molecular formula C17H20N2O7S and a molecular weight of 396.42 g/mol. Its IUPAC name is N-[2,2-dimethoxy-1-(3-methoxyphenyl)ethyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2,2-dimethoxy-1-(3-methoxyphenyl)ethyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 162373676 |
| Molecular Formula | C17H20N2O7S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[2,2-dimethoxy-1-(3-methoxyphenyl)ethyl]-4-nitrobenzenesulfonamide |
| SMILES | COc1cccc(C(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)C(OC)OC)c1 |
| InChI | InChI=1S/C17H20N2O7S/c1-24-14-6-4-5-12(11-14)16(17(25-2)26-3)18-27(22,23)15-9-7-13(8-10-15)19(20)21/h4-11,16-18H,1-3H3 |
| InChIKey | QMRZZZUSCDVPSL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|