C9H14N4O — CID 162380687
ethane;5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide (PubChem CID 162380687) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is ethane;5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide.
| Compound Name | ethane;5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162380687 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | ethane;5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide |
| SMILES | C#Cc1[nH]nc(NC)c1C(N)=O.CC |
| InChI | InChI=1S/C7H8N4O.C2H6/c1-3-4-5(6(8)12)7(9-2)11-10-4;1-2/h1H,2H3,(H2,8,12)(H2,9,10,11);1-2H3 |
| InChIKey | JIUPRKKPVYNNDV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|