C16H25N5O2 — CID 162381328
ethane;5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide;1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 162381328) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is ethane;5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide;1-pyrrolidin-1-ylprop-2-en-1-one.
| Compound Name | ethane;5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide;1-pyrrolidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 162381328 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | ethane;5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide;1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | C#Cc1[nH]nc(NC)c1C(N)=O.C=CC(=O)N1CCCC1.CC |
| InChI | InChI=1S/C7H8N4O.C7H11NO.C2H6/c1-3-4-5(6(8)12)7(9-2)11-10-4;1-2-7(9)8-5-3-4-6-8;1-2/h1H,2H3,(H2,8,12)(H2,9,10,11);2H,1,3-6H2;1-2H3 |
| InChIKey | YFYDYEHJAZTHEZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|