C11H17N5O — CID 162381055
5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide;pyrrolidine (PubChem CID 162381055) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide;pyrrolidine.
| Compound Name | 5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide;pyrrolidine |
|---|---|
| PubChem CID | 162381055 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide;pyrrolidine |
| SMILES | C#Cc1[nH]nc(NC)c1C(N)=O.C1CCNC1 |
| InChI | InChI=1S/C7H8N4O.C4H9N/c1-3-4-5(6(8)12)7(9-2)11-10-4;1-2-4-5-3-1/h1H,2H3,(H2,8,12)(H2,9,10,11);5H,1-4H2 |
| InChIKey | XSJNGXBGRRYNQR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|