C12H17N5O — CID 162381510
3-ethynyl-5-(methylamino)-1-[(3S,5S)-5-methylpyrrolidin-3-yl]pyrazole-4-carboxamide (PubChem CID 162381510) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-ethynyl-5-(methylamino)-1-[(3S,5S)-5-methylpyrrolidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 3-ethynyl-5-(methylamino)-1-[(3S,5S)-5-methylpyrrolidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162381510 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 3-ethynyl-5-(methylamino)-1-[(3S,5S)-5-methylpyrrolidin-3-yl]pyrazole-4-carboxamide |
| SMILES | C#Cc1nn([C@@H]2CN[C@@H](C)C2)c(NC)c1C(N)=O |
| InChI | InChI=1S/C12H17N5O/c1-4-9-10(11(13)18)12(14-3)17(16-9)8-5-7(2)15-6-8/h1,7-8,14-15H,5-6H2,2-3H3,(H2,13,18)/t7-,8-/m0/s1 |
| InChIKey | RUQUAOQKRJKSND-YUMQZZPRSA-N |
| XLogP | -0.07 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|