C12H16BrN5O2 — CID 162381159
3-bromo-5-(methylamino)-1-(1-prop-2-enoylpyrrolidin-3-yl)pyrazole-4-carboxamide (PubChem CID 162381159) has the molecular formula C12H16BrN5O2 and a molecular weight of 342.20 g/mol. Its IUPAC name is 3-bromo-5-(methylamino)-1-(1-prop-2-enoylpyrrolidin-3-yl)pyrazole-4-carboxamide.
| Compound Name | 3-bromo-5-(methylamino)-1-(1-prop-2-enoylpyrrolidin-3-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 162381159 |
| Molecular Formula | C12H16BrN5O2 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 3-bromo-5-(methylamino)-1-(1-prop-2-enoylpyrrolidin-3-yl)pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CCC(n2nc(Br)c(C(N)=O)c2NC)C1 |
| InChI | InChI=1S/C12H16BrN5O2/c1-3-8(19)17-5-4-7(6-17)18-12(15-2)9(11(14)20)10(13)16-18/h3,7,15H,1,4-6H2,2H3,(H2,14,20) |
| InChIKey | LVNOHIPCLQZTPZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|