C14H28IN3O3 — CID 162384823
trimethyl-[2-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]amino]-2-oxoethyl]azanium iodide (PubChem CID 162384823) has the molecular formula C14H28IN3O3 and a molecular weight of 413.30 g/mol. Its IUPAC name is trimethyl-[2-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]amino]-2-oxoethyl]azanium iodide.
| Compound Name | trimethyl-[2-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]amino]-2-oxoethyl]azanium iodide |
|---|---|
| PubChem CID | 162384823 |
| Molecular Formula | C14H28IN3O3 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | trimethyl-[2-[[3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutyl]amino]-2-oxoethyl]azanium iodide |
| SMILES | CC(C)(C)OC(=O)NC1CC(NC(=O)C[N+](C)(C)C)C1.[I-] |
| InChI | InChI=1S/C14H27N3O3.HI/c1-14(2,3)20-13(19)16-11-7-10(8-11)15-12(18)9-17(4,5)6;/h10-11H,7-9H2,1-6H3,(H-,15,16,18,19);1H |
| InChIKey | VIVNKBMWMFYSIN-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|