C20H34N4O3 — CID 162387217
acetamide;(2S)-2-(hexylcarbamoylamino)-N-(2-phenylethyl)propanamide (PubChem CID 162387217) has the molecular formula C20H34N4O3 and a molecular weight of 378.52 g/mol. Its IUPAC name is acetamide;(2S)-2-(hexylcarbamoylamino)-N-(2-phenylethyl)propanamide.
| Compound Name | acetamide;(2S)-2-(hexylcarbamoylamino)-N-(2-phenylethyl)propanamide |
|---|---|
| PubChem CID | 162387217 |
| Molecular Formula | C20H34N4O3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | acetamide;(2S)-2-(hexylcarbamoylamino)-N-(2-phenylethyl)propanamide |
| SMILES | CC(N)=O.CCCCCCNC(=O)N[C@@H](C)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C18H29N3O2.C2H5NO/c1-3-4-5-9-13-20-18(23)21-15(2)17(22)19-14-12-16-10-7-6-8-11-16;1-2(3)4/h6-8,10-11,15H,3-5,9,12-14H2,1-2H3,(H,19,22)(H2,20,21,23);1H3,(H2,3,4)/t15-;/m0./s1 |
| InChIKey | AAWKQGMRJJUREP-RSAXXLAASA-N |
| XLogP | 2.10 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|