C15H24N4O3 — CID 162387371
N-[(2R)-4-amino-1-(1H-imidazol-2-yl)-1,4-dioxobutan-2-yl]octanamide (PubChem CID 162387371) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[(2R)-4-amino-1-(1H-imidazol-2-yl)-1,4-dioxobutan-2-yl]octanamide.
| Compound Name | N-[(2R)-4-amino-1-(1H-imidazol-2-yl)-1,4-dioxobutan-2-yl]octanamide |
|---|---|
| PubChem CID | 162387371 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | N-[(2R)-4-amino-1-(1H-imidazol-2-yl)-1,4-dioxobutan-2-yl]octanamide |
| SMILES | CCCCCCCC(=O)N[C@H](CC(N)=O)C(=O)c1ncc[nH]1 |
| InChI | InChI=1S/C15H24N4O3/c1-2-3-4-5-6-7-13(21)19-11(10-12(16)20)14(22)15-17-8-9-18-15/h8-9,11H,2-7,10H2,1H3,(H2,16,20)(H,17,18)(H,19,21)/t11-/m1/s1 |
| InChIKey | OSAMXTXJWBFHIL-LLVKDONJSA-N |
| XLogP | 1.31 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|