C17H20ClN3O3S2 — CID 162391064
2-[(2R)-2-amino-3-methylsulfonylpropyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine (PubChem CID 162391064) has the molecular formula C17H20ClN3O3S2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 2-[(2R)-2-amino-3-methylsulfonylpropyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(2R)-2-amino-3-methylsulfonylpropyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 162391064 |
| Molecular Formula | C17H20ClN3O3S2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 2-[(2R)-2-amino-3-methylsulfonylpropyl]-5-chloro-N-(furan-2-ylmethyl)-3-methylthieno[3,2-b]pyridin-7-amine |
| SMILES | Cc1c(C[C@@H](N)CS(C)(=O)=O)sc2c(NCc3ccco3)cc(Cl)nc12 |
| InChI | InChI=1S/C17H20ClN3O3S2/c1-10-14(6-11(19)9-26(2,22)23)25-17-13(7-15(18)21-16(10)17)20-8-12-4-3-5-24-12/h3-5,7,11H,6,8-9,19H2,1-2H3,(H,20,21)/t11-/m1/s1 |
| InChIKey | GVKGTWGXOITJRP-LLVKDONJSA-N |
| XLogP | 3.38 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|