C15H14Cl2FN3OS — CID 162391038
2-[(2R)-2-amino-3-fluoropropyl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine (PubChem CID 162391038) has the molecular formula C15H14Cl2FN3OS and a molecular weight of 374.27 g/mol. Its IUPAC name is 2-[(2R)-2-amino-3-fluoropropyl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(2R)-2-amino-3-fluoropropyl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 162391038 |
| Molecular Formula | C15H14Cl2FN3OS |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 2-[(2R)-2-amino-3-fluoropropyl]-3,5-dichloro-N-(furan-2-ylmethyl)thieno[3,2-b]pyridin-7-amine |
| SMILES | N[C@@H](CF)Cc1sc2c(NCc3ccco3)cc(Cl)nc2c1Cl |
| InChI | InChI=1S/C15H14Cl2FN3OS/c16-12-5-10(20-7-9-2-1-3-22-9)15-14(21-12)13(17)11(23-15)4-8(19)6-18/h1-3,5,8H,4,6-7,19H2,(H,20,21)/t8-/m1/s1 |
| InChIKey | RMCBRNBMWVARDB-MRVPVSSYSA-N |
| XLogP | 4.65 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|