C20H46N4O6S — CID 162394187
bis([(1-cyclohexyl-1-hydroxypropan-2-yl)-methylamino]azanium);sulfate (PubChem CID 162394187) has the molecular formula C20H46N4O6S and a molecular weight of 470.68 g/mol. Its IUPAC name is bis([(1-cyclohexyl-1-hydroxypropan-2-yl)-methylamino]azanium);sulfate.
| Compound Name | bis([(1-cyclohexyl-1-hydroxypropan-2-yl)-methylamino]azanium);sulfate |
|---|---|
| PubChem CID | 162394187 |
| Molecular Formula | C20H46N4O6S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.31 |
| IUPAC Name | bis([(1-cyclohexyl-1-hydroxypropan-2-yl)-methylamino]azanium);sulfate |
| SMILES | CC(C(O)C1CCCCC1)N(C)[NH3+].CC(C(O)C1CCCCC1)N(C)[NH3+].O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C10H22N2O.H2O4S/c2*1-8(12(2)11)10(13)9-6-4-3-5-7-9;1-5(2,3)4/h2*8-10,13H,3-7,11H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | JSTLMSNINMYZJM-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 182.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|