C18H12ClNO2 — CID 162398031
2-amino-3-[(E)-2-(4-chlorophenyl)ethenyl]naphthalene-1,4-dione (PubChem CID 162398031) has the molecular formula C18H12ClNO2 and a molecular weight of 309.75 g/mol. Its IUPAC name is 2-amino-3-[(E)-2-(4-chlorophenyl)ethenyl]naphthalene-1,4-dione.
| Compound Name | 2-amino-3-[(E)-2-(4-chlorophenyl)ethenyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 162398031 |
| Molecular Formula | C18H12ClNO2 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-amino-3-[(E)-2-(4-chlorophenyl)ethenyl]naphthalene-1,4-dione |
| SMILES | NC1=C(/C=C/c2ccc(Cl)cc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H12ClNO2/c19-12-8-5-11(6-9-12)7-10-15-16(20)18(22)14-4-2-1-3-13(14)17(15)21/h1-10H,20H2/b10-7+ |
| InChIKey | CXMJFORZVATSLT-JXMROGBWSA-N |
| XLogP | 3.65 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|