C19H25NO4 — CID 162398918
diethyl 1,2,3,4,6,11a-hexahydrobenzo[b]quinolizine-11,11-dicarboxylate (PubChem CID 162398918) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is diethyl 1,2,3,4,6,11a-hexahydrobenzo[b]quinolizine-11,11-dicarboxylate.
| Compound Name | diethyl 1,2,3,4,6,11a-hexahydrobenzo[b]quinolizine-11,11-dicarboxylate |
|---|---|
| PubChem CID | 162398918 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | diethyl 1,2,3,4,6,11a-hexahydrobenzo[b]quinolizine-11,11-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)c2ccccc2CN2CCCCC21 |
| InChI | InChI=1S/C19H25NO4/c1-3-23-17(21)19(18(22)24-4-2)15-10-6-5-9-14(15)13-20-12-8-7-11-16(19)20/h5-6,9-10,16H,3-4,7-8,11-13H2,1-2H3 |
| InChIKey | LXIQOIQZPFTTMR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|