C12H19BO3 — CID 162400833
2-[(1S)-1-(furan-3-yl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 162400833) has the molecular formula C12H19BO3 and a molecular weight of 222.09 g/mol. Its IUPAC name is 2-[(1S)-1-(furan-3-yl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1S)-1-(furan-3-yl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 162400833 |
| Molecular Formula | C12H19BO3 |
| Molecular Weight | 222.09 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-[(1S)-1-(furan-3-yl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C[C@H](B1OC(C)(C)C(C)(C)O1)c1ccoc1 |
| InChI | InChI=1S/C12H19BO3/c1-9(10-6-7-14-8-10)13-15-11(2,3)12(4,5)16-13/h6-9H,1-5H3/t9-/m0/s1 |
| InChIKey | ZLTSRZNKKQPKDK-VIFPVBQESA-N |
| XLogP | 3.01 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.09 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|