C16H20O2 — CID 162402238
2-methoxy-4-phenyl-1-oxaspiro[4.5]dec-3-ene (PubChem CID 162402238) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-methoxy-4-phenyl-1-oxaspiro[4.5]dec-3-ene.
| Compound Name | 2-methoxy-4-phenyl-1-oxaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 162402238 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 2-methoxy-4-phenyl-1-oxaspiro[4.5]dec-3-ene |
| SMILES | COC1C=C(c2ccccc2)C2(CCCCC2)O1 |
| InChI | InChI=1S/C16H20O2/c1-17-15-12-14(13-8-4-2-5-9-13)16(18-15)10-6-3-7-11-16/h2,4-5,8-9,12,15H,3,6-7,10-11H2,1H3 |
| InChIKey | RQMHOYOXNROGRC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |