C14H12N2 — CID 162403249
3-phenyl-1,3-dihydroazirino[2,1-i]benzimidazole (PubChem CID 162403249) has the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-phenyl-1,3-dihydroazirino[2,1-i]benzimidazole.
| Compound Name | 3-phenyl-1,3-dihydroazirino[2,1-i]benzimidazole |
|---|---|
| PubChem CID | 162403249 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 3-phenyl-1,3-dihydroazirino[2,1-i]benzimidazole |
| SMILES | C1=CC2=NC(c3ccccc3)N3CC23C=C1 |
| InChI | InChI=1S/C14H12N2/c1-2-6-11(7-3-1)13-15-12-8-4-5-9-14(12)10-16(13)14/h1-9,13H,10H2 |
| InChIKey | VXSYXWULYKBUHA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|