C13H22O4 — CID 162407453
6-butyl-2-methoxy-2-methyl-1,7,10-trioxaspiro[4.5]dec-3-ene (PubChem CID 162407453) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 6-butyl-2-methoxy-2-methyl-1,7,10-trioxaspiro[4.5]dec-3-ene.
| Compound Name | 6-butyl-2-methoxy-2-methyl-1,7,10-trioxaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 162407453 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 6-butyl-2-methoxy-2-methyl-1,7,10-trioxaspiro[4.5]dec-3-ene |
| SMILES | CCCCC1OCCOC12C=CC(C)(OC)O2 |
| InChI | InChI=1S/C13H22O4/c1-4-5-6-11-13(16-10-9-15-11)8-7-12(2,14-3)17-13/h7-8,11H,4-6,9-10H2,1-3H3 |
| InChIKey | GSBIMSQGIZEFBU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|