C12H13F3O7S — CID 162407703
[4-[(2R,6S)-5-hydroxy-6-(hydroxymethyl)-1,4-dioxan-2-yl]phenyl] trifluoromethanesulfonate (PubChem CID 162407703) has the molecular formula C12H13F3O7S and a molecular weight of 358.29 g/mol. Its IUPAC name is [4-[(2R,6S)-5-hydroxy-6-(hydroxymethyl)-1,4-dioxan-2-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(2R,6S)-5-hydroxy-6-(hydroxymethyl)-1,4-dioxan-2-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162407703 |
| Molecular Formula | C12H13F3O7S |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | [4-[(2R,6S)-5-hydroxy-6-(hydroxymethyl)-1,4-dioxan-2-yl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc([C@@H]2COC(O)[C@H](CO)O2)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O7S/c13-12(14,15)23(18,19)22-8-3-1-7(2-4-8)10-6-20-11(17)9(5-16)21-10/h1-4,9-11,16-17H,5-6H2/t9-,10-,11?/m0/s1 |
| InChIKey | PTBVFWRBSCEDJY-QRHSGQBVSA-N |
| XLogP | 0.68 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|