C16H13N3 — CID 162409606
12-methylindolo[1,2-c]quinazolin-6-amine (PubChem CID 162409606) has the molecular formula C16H13N3 and a molecular weight of 247.30 g/mol. Its IUPAC name is 12-methylindolo[1,2-c]quinazolin-6-amine.
| Compound Name | 12-methylindolo[1,2-c]quinazolin-6-amine |
|---|---|
| PubChem CID | 162409606 |
| Molecular Formula | C16H13N3 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 12-methylindolo[1,2-c]quinazolin-6-amine |
| SMILES | Cc1c2ccccc2n2c(N)nc3ccccc3c12 |
| InChI | InChI=1S/C16H13N3/c1-10-11-6-3-5-9-14(11)19-15(10)12-7-2-4-8-13(12)18-16(19)17/h2-9H,1H3,(H2,17,18) |
| InChIKey | BIHHWSCOUIVJLO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |