C14H14N2 — CID 23517333
2,4,10-trimethylpyrimido[1,2-a]indole (PubChem CID 23517333) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2,4,10-trimethylpyrimido[1,2-a]indole.
| Compound Name | 2,4,10-trimethylpyrimido[1,2-a]indole |
|---|---|
| PubChem CID | 23517333 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2,4,10-trimethylpyrimido[1,2-a]indole |
| SMILES | Cc1cc(C)n2c(n1)c(C)c1ccccc12 |
| InChI | InChI=1S/C14H14N2/c1-9-8-10(2)16-13-7-5-4-6-12(13)11(3)14(16)15-9/h4-8H,1-3H3 |
| InChIKey | XGCUMVPBXXPEHS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |