C13H15NO2 — CID 162410241
(1S,3aS,8bR)-1-propan-2-yl-1,3,3a,8b-tetrahydro-[1]benzofuro[2,3-b]pyrrol-2-one (PubChem CID 162410241) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (1S,3aS,8bR)-1-propan-2-yl-1,3,3a,8b-tetrahydro-[1]benzofuro[2,3-b]pyrrol-2-one.
| Compound Name | (1S,3aS,8bR)-1-propan-2-yl-1,3,3a,8b-tetrahydro-[1]benzofuro[2,3-b]pyrrol-2-one |
|---|---|
| PubChem CID | 162410241 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (1S,3aS,8bR)-1-propan-2-yl-1,3,3a,8b-tetrahydro-[1]benzofuro[2,3-b]pyrrol-2-one |
| SMILES | CC(C)[C@@H]1C(=O)N[C@H]2Oc3ccccc3[C@H]21 |
| InChI | InChI=1S/C13H15NO2/c1-7(2)10-11-8-5-3-4-6-9(8)16-13(11)14-12(10)15/h3-7,10-11,13H,1-2H3,(H,14,15)/t10-,11-,13-/m0/s1 |
| InChIKey | WDOPKUXVHBXZRN-GVXVVHGQSA-N |
| XLogP | 1.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |