C14H17NO2 — CID 162406866
(1S,3aS,8bR)-1-tert-butyl-1,3,3a,8b-tetrahydro-[1]benzofuro[2,3-b]pyrrol-2-one (PubChem CID 162406866) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is (1S,3aS,8bR)-1-tert-butyl-1,3,3a,8b-tetrahydro-[1]benzofuro[2,3-b]pyrrol-2-one.
| Compound Name | (1S,3aS,8bR)-1-tert-butyl-1,3,3a,8b-tetrahydro-[1]benzofuro[2,3-b]pyrrol-2-one |
|---|---|
| PubChem CID | 162406866 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (1S,3aS,8bR)-1-tert-butyl-1,3,3a,8b-tetrahydro-[1]benzofuro[2,3-b]pyrrol-2-one |
| SMILES | CC(C)(C)[C@H]1C(=O)N[C@H]2Oc3ccccc3[C@H]21 |
| InChI | InChI=1S/C14H17NO2/c1-14(2,3)11-10-8-6-4-5-7-9(8)17-13(10)15-12(11)16/h4-7,10-11,13H,1-3H3,(H,15,16)/t10-,11+,13-/m0/s1 |
| InChIKey | YUPXMRVDSZGKFE-LOWVWBTDSA-N |
| XLogP | 2.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |