C16H18N2O4 — CID 99796567
(1R,2S,7R,10R)-9,9-dimethyl-8,12-dioxa-4,6-diazatetracyclo[8.8.0.02,7.013,18]octadeca-13,15,17-triene-3,5-dione (PubChem CID 99796567) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (1R,2S,7R,10R)-9,9-dimethyl-8,12-dioxa-4,6-diazatetracyclo[8.8.0.02,7.013,18]octadeca-13,15,17-triene-3,5-dione.
| Compound Name | (1R,2S,7R,10R)-9,9-dimethyl-8,12-dioxa-4,6-diazatetracyclo[8.8.0.02,7.013,18]octadeca-13,15,17-triene-3,5-dione |
|---|---|
| PubChem CID | 99796567 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (1R,2S,7R,10R)-9,9-dimethyl-8,12-dioxa-4,6-diazatetracyclo[8.8.0.02,7.013,18]octadeca-13,15,17-triene-3,5-dione |
| SMILES | CC1(C)O[C@H]2NC(=O)NC(=O)[C@H]2[C@@H]2c3ccccc3OC[C@@H]21 |
| InChI | InChI=1S/C16H18N2O4/c1-16(2)9-7-21-10-6-4-3-5-8(10)11(9)12-13(19)17-15(20)18-14(12)22-16/h3-6,9,11-12,14H,7H2,1-2H3,(H2,17,18,19,20)/t9-,11+,12+,14+/m0/s1 |
| InChIKey | RABQDEDLDXSAFJ-LEJCRSTHSA-N |
| XLogP | 1.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |