C21H26O4 — CID 162410328
(5S,10S,13R,14S)-10-(methoxymethoxymethyl)-13-methyl-4,5,6,11,12,14-hexahydro-3H-cyclopenta[a]phenanthrene-7,15-dione (PubChem CID 162410328) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (5S,10S,13R,14S)-10-(methoxymethoxymethyl)-13-methyl-4,5,6,11,12,14-hexahydro-3H-cyclopenta[a]phenanthrene-7,15-dione.
| Compound Name | (5S,10S,13R,14S)-10-(methoxymethoxymethyl)-13-methyl-4,5,6,11,12,14-hexahydro-3H-cyclopenta[a]phenanthrene-7,15-dione |
|---|---|
| PubChem CID | 162410328 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (5S,10S,13R,14S)-10-(methoxymethoxymethyl)-13-methyl-4,5,6,11,12,14-hexahydro-3H-cyclopenta[a]phenanthrene-7,15-dione |
| SMILES | COCOC[C@]12C=CCC[C@H]1CC(=O)C1=C2CC[C@]2(C)C=CC(=O)[C@H]12 |
| InChI | InChI=1S/C21H26O4/c1-20-9-6-15-18(19(20)16(22)7-10-20)17(23)11-14-5-3-4-8-21(14,15)12-25-13-24-2/h4,7-8,10,14,19H,3,5-6,9,11-13H2,1-2H3/t14-,19+,20+,21+/m0/s1 |
| InChIKey | NCRAZSYGGMJBOS-RKTMXUFFSA-N |
| XLogP | 3.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|