C17H26O3 — CID 10062111
(4aR,8aR)-3-(2,2-dimethoxyethyl)-4a,8,8-trimethyl-7,8a-dihydro-1H-naphthalen-2-one (PubChem CID 10062111) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (4aR,8aR)-3-(2,2-dimethoxyethyl)-4a,8,8-trimethyl-7,8a-dihydro-1H-naphthalen-2-one.
| Compound Name | (4aR,8aR)-3-(2,2-dimethoxyethyl)-4a,8,8-trimethyl-7,8a-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 10062111 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (4aR,8aR)-3-(2,2-dimethoxyethyl)-4a,8,8-trimethyl-7,8a-dihydro-1H-naphthalen-2-one |
| SMILES | COC(CC1=C[C@@]2(C)C=CCC(C)(C)[C@H]2CC1=O)OC |
| InChI | InChI=1S/C17H26O3/c1-16(2)7-6-8-17(3)11-12(9-15(19-4)20-5)13(18)10-14(16)17/h6,8,11,14-15H,7,9-10H2,1-5H3/t14-,17-/m1/s1 |
| InChIKey | VFSVTENBBYRDKW-RHSMWYFYSA-N |
| XLogP | 3.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|