C20H27F3N2O2 — CID 162412399
tert-butyl (3aS,7aS)-2-benzyl-7a-(trifluoromethyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine-5-carboxylate (PubChem CID 162412399) has the molecular formula C20H27F3N2O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is tert-butyl (3aS,7aS)-2-benzyl-7a-(trifluoromethyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl (3aS,7aS)-2-benzyl-7a-(trifluoromethyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 162412399 |
| Molecular Formula | C20H27F3N2O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | tert-butyl (3aS,7aS)-2-benzyl-7a-(trifluoromethyl)-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@]2(C(F)(F)F)CN(Cc3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C20H27F3N2O2/c1-18(2,3)27-17(26)25-10-9-19(20(21,22)23)14-24(12-16(19)13-25)11-15-7-5-4-6-8-15/h4-8,16H,9-14H2,1-3H3/t16-,19+/m0/s1 |
| InChIKey | DBQWXAMOSWTGAP-QFBILLFUSA-N |
| XLogP | 4.31 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |