C10H15NO — CID 162413200
2-[(1S,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile (PubChem CID 162413200) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-[(1S,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile.
| Compound Name | 2-[(1S,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile |
|---|---|
| PubChem CID | 162413200 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-[(1S,4E)-1-hydroxycyclooct-4-en-1-yl]acetonitrile |
| SMILES | N#CC[C@@]1(O)CC/C=C\CCC1 |
| InChI | InChI=1S/C10H15NO/c11-9-8-10(12)6-4-2-1-3-5-7-10/h1-2,12H,3-8H2/b2-1-/t10-/m1/s1 |
| InChIKey | RRECDXKOCCKGAH-JWXWKVPASA-N |
| XLogP | 2.15 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|