About (E)-3-hydroxy-3-methylnon-6-enenitrile;propane
(E)-3-hydroxy-3-methylnon-6-enenitrile;propane (PubChem CID 164540435) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is (E)-3-hydroxy-3-methylnon-6-enenitrile;propane.
Molecular Properties
| Compound Name | (E)-3-hydroxy-3-methylnon-6-enenitrile;propane |
| PubChem CID | 164540435 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (E)-3-hydroxy-3-methylnon-6-enenitrile;propane |
| SMILES | CC/C=C/CCC(C)(O)CC#N.CCC |
| InChI | InChI=1S/C10H17NO.C3H8/c1-3-4-5-6-7-10(2,12)8-9-11;1-3-2/h4-5,12H,3,6-8H2,1-2H3;3H2,1-2H3/b5-4+; |
| InChIKey | ZUHIKQOWXDCNJY-FXRZFVDSSA-N |
| XLogP | 3.81 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-hydroxy-3-methylnon-6-enenitrile;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-hydroxy-3-methylnon-6-enenitrile;propane?
The IUPAC name of (E)-3-hydroxy-3-methylnon-6-enenitrile;propane (CID 164540435) is (E)-3-hydroxy-3-methylnon-6-enenitrile;propane.
What is the SMILES notation for (E)-3-hydroxy-3-methylnon-6-enenitrile;propane?
The canonical SMILES for (E)-3-hydroxy-3-methylnon-6-enenitrile;propane is CC/C=C/CCC(C)(O)CC#N.CCC.
What is the InChIKey of (E)-3-hydroxy-3-methylnon-6-enenitrile;propane?
The InChIKey is ZUHIKQOWXDCNJY-FXRZFVDSSA-N. The full InChI is InChI=1S/C10H17NO.C3H8/c1-3-4-5-6-7-10(2,12)8-9-11;1-3-2/h4-5,12H,3,6-8H2,1-2H3;3H2,1-2H3/b5-4+;.
What are the key properties of (E)-3-hydroxy-3-methylnon-6-enenitrile;propane?
(E)-3-hydroxy-3-methylnon-6-enenitrile;propane has a molecular weight of 211.35 g/mol, XLogP of 3.81, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-hydroxy-3-methylnon-6-enenitrile;propane is sourced from PubChem (CID 164540435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).