C9H14O2S — CID 162413490
(7aS)-3-methyl-2,4,5,6,7,7a-hexahydro-1-benzothiophene 1,1-dioxide (PubChem CID 162413490) has the molecular formula C9H14O2S and a molecular weight of 186.28 g/mol. Its IUPAC name is (7aS)-3-methyl-2,4,5,6,7,7a-hexahydro-1-benzothiophene 1,1-dioxide.
| Compound Name | (7aS)-3-methyl-2,4,5,6,7,7a-hexahydro-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 162413490 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (7aS)-3-methyl-2,4,5,6,7,7a-hexahydro-1-benzothiophene 1,1-dioxide |
| SMILES | CC1=C2CCCC[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C9H14O2S/c1-7-6-12(10,11)9-5-3-2-4-8(7)9/h9H,2-6H2,1H3/t9-/m0/s1 |
| InChIKey | UPMBRXZYDHBLPP-VIFPVBQESA-N |
| XLogP | 1.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|