C17H27BrO3 — CID 162413568
[(2R,4aS,6S,8aR)-6-(bromomethyl)-4a-methyl-5-oxo-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 162413568) has the molecular formula C17H27BrO3 and a molecular weight of 359.30 g/mol. Its IUPAC name is [(2R,4aS,6S,8aR)-6-(bromomethyl)-4a-methyl-5-oxo-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,4aS,6S,8aR)-6-(bromomethyl)-4a-methyl-5-oxo-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 162413568 |
| Molecular Formula | C17H27BrO3 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [(2R,4aS,6S,8aR)-6-(bromomethyl)-4a-methyl-5-oxo-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@@H]1CC[C@]2(C)C(=O)[C@@H](CBr)CC[C@@H]2C1 |
| InChI | InChI=1S/C17H27BrO3/c1-16(2,3)15(20)21-13-7-8-17(4)12(9-13)6-5-11(10-18)14(17)19/h11-13H,5-10H2,1-4H3/t11-,12-,13-,17+/m1/s1 |
| InChIKey | RTGWRLUZSNYRTP-ZFRZLUBXSA-N |
| XLogP | 4.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|