C20H26O4S2 — CID 162416384
(1S,5R,6S,9R)-3,3-dimethyl-6-(2-phenylmethoxyethyl)-2,4-dioxa-8,10-dithiatricyclo[7.4.0.01,5]tridecan-13-one (PubChem CID 162416384) has the molecular formula C20H26O4S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is (1S,5R,6S,9R)-3,3-dimethyl-6-(2-phenylmethoxyethyl)-2,4-dioxa-8,10-dithiatricyclo[7.4.0.01,5]tridecan-13-one.
| Compound Name | (1S,5R,6S,9R)-3,3-dimethyl-6-(2-phenylmethoxyethyl)-2,4-dioxa-8,10-dithiatricyclo[7.4.0.01,5]tridecan-13-one |
|---|---|
| PubChem CID | 162416384 |
| Molecular Formula | C20H26O4S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (1S,5R,6S,9R)-3,3-dimethyl-6-(2-phenylmethoxyethyl)-2,4-dioxa-8,10-dithiatricyclo[7.4.0.01,5]tridecan-13-one |
| SMILES | CC1(C)O[C@@H]2[C@H](CCOCc3ccccc3)CS[C@H]3SCCC(=O)[C@]32O1 |
| InChI | InChI=1S/C20H26O4S2/c1-19(2)23-17-15(8-10-22-12-14-6-4-3-5-7-14)13-26-18-20(17,24-19)16(21)9-11-25-18/h3-7,15,17-18H,8-13H2,1-2H3/t15-,17-,18-,20-/m1/s1 |
| InChIKey | VGEHNIPSDFOAJB-DLVXIWMQSA-N |
| XLogP | 3.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|