C34H35O3P — CID 162416516
2-[2-bis(3-methylphenyl)phosphoryl-4-methylphenyl]-4,4-dimethyl-1-phenylpentane-1,3-dione (PubChem CID 162416516) has the molecular formula C34H35O3P and a molecular weight of 522.63 g/mol. Its IUPAC name is 2-[2-bis(3-methylphenyl)phosphoryl-4-methylphenyl]-4,4-dimethyl-1-phenylpentane-1,3-dione.
| Compound Name | 2-[2-bis(3-methylphenyl)phosphoryl-4-methylphenyl]-4,4-dimethyl-1-phenylpentane-1,3-dione |
|---|---|
| PubChem CID | 162416516 |
| Molecular Formula | C34H35O3P |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 2-[2-bis(3-methylphenyl)phosphoryl-4-methylphenyl]-4,4-dimethyl-1-phenylpentane-1,3-dione |
| SMILES | Cc1cccc(P(=O)(c2cccc(C)c2)c2cc(C)ccc2C(C(=O)c2ccccc2)C(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C34H35O3P/c1-23-12-10-16-27(20-23)38(37,28-17-11-13-24(2)21-28)30-22-25(3)18-19-29(30)31(33(36)34(4,5)6)32(35)26-14-8-7-9-15-26/h7-22,31H,1-6H3 |
| InChIKey | LCMOECCPNZAOFV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|