C32H39NO6Si — CID 162417420
methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-triphenylsilylpropanoate (PubChem CID 162417420) has the molecular formula C32H39NO6Si and a molecular weight of 561.75 g/mol. Its IUPAC name is methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-triphenylsilylpropanoate.
| Compound Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-triphenylsilylpropanoate |
|---|---|
| PubChem CID | 162417420 |
| Molecular Formula | C32H39NO6Si |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | methyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-triphenylsilylpropanoate |
| SMILES | COC(=O)C(C[Si](c1ccccc1)(c1ccccc1)c1ccccc1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H39NO6Si/c1-31(2,3)38-29(35)33(30(36)39-32(4,5)6)27(28(34)37-7)23-40(24-17-11-8-12-18-24,25-19-13-9-14-20-25)26-21-15-10-16-22-26/h8-22,27H,23H2,1-7H3 |
| InChIKey | LINYMYGTLURSCW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|